21906-32-1 3-Bromophenylacetone
| Nome del prodotto |
3-Bromophenylacetone |
| Nome inglese |
3-Bromophenylacetone; 3-bromophenylacetonone; 1-(3-bromophenyl)propan-2-one |
| Formula molecolare |
C9H9BrO |
| Peso Molecolare |
213.0712 |
| InChI |
InChI=1/C9H9BrO/c1-7(11)5-8-3-2-4-9(10)6-8/h2-4,6H,5H2,1H3 |
| Numero CAS |
21906-32-1 |
| Struttura molecolare |
|
| Densità |
1.401g/cm3 |
| Punto di ebollizione |
265.7°C at 760 mmHg |
| Indice di rifrazione |
1.546 |
| Punto d'infiammabilità |
75.9°C |
| Pressione di vapore |
0.00903mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|