2058-58-4 D(-)-Asparagine
| Nome del prodotto |
D(-)-Asparagine |
| Nome inglese |
D(-)-Asparagine; D-2-Aminosuccinamic acid; H-D-Asn-OH; D-asparagine anhydrous; D-2-Aminosuccinamic acid; D-asparagine; (2R)-2-aminobutanedioic acid; D-AsparagineAnhydrous |
| Formula molecolare |
C4H8N2O3 |
| Peso Molecolare |
132.1191 |
| InChI |
InChI:1S/C4H8N2O3/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H2,6,7)(H,8,9) |
| Numero CAS |
2058-58-4 |
| EINECS |
218-163-3 |
| Struttura molecolare |
|
| Densità |
1.404 g/cm3 |
| Punto di fusione |
280℃ (dec.) |
| Punto di ebollizione |
361°C at 760 mmHg |
| Punto d'infiammabilità |
172.1°C |
| Pressione di vapore |
2.38E-06mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|