ChemNet > CAS > 1875-89-4 3-Methylphenethyl alcohol
1875-89-4 3-Methylphenethyl alcohol
| Nome del prodotto |
3-Methylphenethyl alcohol |
| Nome inglese |
3-Methylphenethyl alcohol; 2-m-tolylethanol; 2-(3-Methylphenyl)ethanol; 2-(4-methylphenyl)ethanol; M-METHYL PHENYL ETHANOL; m-Methylphenethyl alcohol |
| Formula molecolare |
C9H12O |
| Peso Molecolare |
136.191 |
| InChI |
InChI=1/C9H12O/c1-8-2-4-9(5-3-8)6-7-10/h2-5,10H,6-7H2,1H3 |
| Numero CAS |
1875-89-4 |
| EINECS |
217-508-5 |
| Struttura molecolare |
|
| Densità |
1.001g/cm3 |
| Punto di ebollizione |
243.5°C at 760 mmHg |
| Indice di rifrazione |
1.532 |
| Punto d'infiammabilità |
107.2°C |
| Pressione di vapore |
0.0172mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|