15903-94-3 6-benzyloxyindole
| Nome del prodotto |
6-benzyloxyindole |
| Nome inglese |
6-benzyloxyindole;6-(benzyloxy)-1H-indole |
| Formula molecolare |
C15H13NO |
| Peso Molecolare |
223.2698 |
| InChI |
InChI=1/C15H13NO/c1-2-4-12(5-3-1)11-17-14-7-6-13-8-9-16-15(13)10-14/h1-10,16H,11H2 |
| Numero CAS |
15903-94-3 |
| Struttura molecolare |
|
| Densità |
1.196g/cm3 |
| Punto di ebollizione |
411.6°C at 760 mmHg |
| Indice di rifrazione |
1.669 |
| Punto d'infiammabilità |
148.9°C |
| Pressione di vapore |
1.31E-06mmHg at 25°C |
| Sicurezza Descrizione |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|