ChemNet > CAS > 66909-38-4 3-Amino-6-chloro-4-picoline
66909-38-4 3-Amino-6-chloro-4-picoline
| ??? ????? |
3-Amino-6-chloro-4-picoline |
| ??? ??????? |
3-Amino-6-chloro-4-picoline; 2-CHLORO-4-METHYL-5-AMINOPYRIDINE; 6-chloro-4-methylpyridin-3-amine; 5-Amino-2-chloro-4-methylpyridine; 5-amino-2-chloro-4-picoline |
| ????? ???????? |
C6H7ClN2 |
| ??? ??????? |
142.5862 |
| InChI |
InChI=1/C6H7ClN2/c1-4-2-6(7)9-3-5(4)8/h2-3H,8H2,1H3 |
| ????? ?????? |
66909-38-4 |
| ?????? ??????? |
|
| ????? |
1.26g/cm3 |
| ???? ????? |
309.7°C at 760 mmHg |
| ???? ???? |
1.592 |
| ???? ?????? |
141.1°C |
| ???? ???? |
0.000627mmHg at 25°C |
| ??? ?????? |
Xi:Irritant;
|
| ????? ??? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ??????? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|