3048-65-5 Tetrahydroindene
| ??? ????? |
Tetrahydroindene |
| ??? ??????? |
Tetrahydroindene; 3a,4,7,7a-Tetrahydroindene; 3a,4,7,7a-tetrahydro-1H-indene |
| ????? ???????? |
C9H12 |
| ??? ??????? |
120.1916 |
| InChI |
InChI=1/C9H12/c1-2-5-9-7-3-6-8(9)4-1/h1-3,6,8-9H,4-5,7H2 |
| ????? ?????? |
3048-65-5 |
| ????? ??????? ??????? |
221-260-3 |
| ?????? ??????? |
|
| ????? |
0.944g/cm3 |
| ???? ????? |
169.1°C at 760 mmHg |
| ???? ???? |
1.521 |
| ???? ?????? |
33.8°C |
| ???? ???? |
2.08mmHg at 25°C |
| ????? ??? |
R10:Flammable.;
R65:Harmful: may cause lung damage if swallowed.;
|
| ??????? ????? |
S16:Keep away from sources of ignition - No smoking.;
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
S62:If swallowed, do not induce vomiting: seek medical advice immediately and show this container or label.;
|
|