3048-64-4 5-Vinyl-2-norbornene
| ??? ????? |
5-Vinyl-2-norbornene |
| ??? ??????? |
5-Vinyl-2-norbornene; 5-Vinyl-2-norbornene,mixture of endo and exo; Vinylnorbornene; 2-ethenylbicyclo[2.2.1]hept-1-ene; 5-ethenylbicyclo[2.2.1]hept-1-ene |
| ??? ??????? |
C9H8 |
| InChI |
InChI=1/C9H12/c1-2-8-5-7-3-4-9(8)6-7/h2-3,8-9H,1,4-6H2 |
| ????? ?????? |
3048-64-4 |
| ????? ??????? ??????? |
221-259-8 |
| ?????? ??????? |
|
| ????? |
1.612 |
| ???? ??? |
-80℃ |
| ???? ????? |
137.909°C |
| ???? ???? |
144.1732 |
| ???? ?????? |
1.189g/cm3 |
| ???? ???? |
304 |
| ??? ?????? |
Xn:Harmful;
|
| ????? ??? |
R10:Flammable.;
R20:Harmful by inhalation.;
R36/38:Irritating to eyes and skin.;
|
| ??????? ????? |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|