14857-34-2 Dimethylethoxysilane
| ??? ????? |
Dimethylethoxysilane |
| ??? ??????? |
Dimethylethoxysilane; Ethoxydimethylsilane; Ethoxydimethylvinylsilane; Vinyldimethylethoxysilane; ethoxy(dimethyl)silyl |
| ????? ???????? |
C4H11OSi |
| ??? ??????? |
103.215 |
| InChI |
InChI=1/C4H11OSi/c1-4-5-6(2)3/h4H2,1-3H3 |
| ????? ?????? |
14857-34-2 |
| ????? ??????? ??????? |
238-921-7 |
| ?????? ??????? |
|
| ????? ??? |
R11:Highly flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ??????? ????? |
S16:Keep away from sources of ignition - No smoking.;
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|