10477-47-1 Propargyl acrylate
| ??? ????? |
Propargyl acrylate |
| ??? ??????? |
Propargyl acrylate; Acrylic acid propargyl ester~2-Propyn-1-yl propenoate; prop-2-yn-1-yl prop-2-enoate |
| ????? ???????? |
C6H6O2 |
| ??? ??????? |
110.1106 |
| InChI |
InChI=1/C6H6O2/c1-3-5-8-6(7)4-2/h1,4H,2,5H2 |
| ????? ?????? |
10477-47-1 |
| ????? ??????? ??????? |
233-975-8 |
| ?????? ??????? |
|
| ????? |
1.001g/cm3 |
| ???? ????? |
129.1°C at 760 mmHg |
| ???? ???? |
1.443 |
| ???? ?????? |
32.2°C |
| ???? ???? |
10.3mmHg at 25°C |
| ????? ??? |
R10:Flammable.;
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ??????? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|