480-16-0 Morin
| ?????? ?? ??? |
Morin |
| ???????? ??? |
Morin; C.I. 75660; C.I. Natural Yellow 8; 2,3,4,5,7-Pentahydroxyflavone; Fustic; Morin dihydrate; 2-(3,5-dihydroxyphenyl)-3,6,8-trihydroxy-4H-chromen-4-one; 2-(2,4-dihydroxyphenyl)-3,5,7-trihydroxy-4H-chromen-4-one |
| ????? ???????? |
C15H10O7 |
| ?????? ??? |
302.2357 |
| InChI |
InChI=1/C15H10O7/c16-6-1-2-8(9(18)3-6)15-14(21)13(20)12-10(19)4-7(17)5-11(12)22-15/h1-5,16-19,21H |
| ??? ??????? ?????? |
480-16-0 |
| EINECS |
207-542-9 |
| ????? ?????? |
|
| ????? |
1.799g/cm3 |
| ?????? |
300℃ |
| ????? ?? ??? |
645.5°C at 760 mmHg |
| ??????? ??????? |
1.823 |
| ????? ??????? |
249.3°C |
| ????? ?? ???? |
2.94E-17mmHg at 25°C |
| ???? ?????? |
Xi:Irritant;
|
| ???? ?? ??? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ??????? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|