3034-19-3 2-Nitrophenylhydrazine
| ?????? ?? ??? |
2-Nitrophenylhydrazine |
| ???????? ??? |
2-Nitrophenylhydrazine; BRN 0512797; Hydrazine, (o-nitrophenyl)- |
| ????? ???????? |
C6H7N3O2 |
| ?????? ??? |
153.1387 |
| InChI |
InChI=1/C6H7N3O2/c7-8-5-3-1-2-4-6(5)9(10)11/h1-4,8H,7H2 |
| ??? ??????? ?????? |
3034-19-3 |
| EINECS |
221-222-6 |
| ????? ?????? |
|
| ????? |
1.419g/cm3 |
| ?????? |
89-94℃ |
| ????? ?? ??? |
314.3°C at 760 mmHg |
| ??????? ??????? |
1.691 |
| ????? ??????? |
143.9°C |
| ????? ?? ???? |
0.000469mmHg at 25°C |
| ???? ?????? |
Xi:Irritant;
|
| ???? ?? ??? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
R5:Heating may cause an explosion.;
|
| ??????? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|