2216-94-6 Ethyl phenylpropiolate
| Nama produk |
Ethyl phenylpropiolate |
| Nama bahasa Inggris |
Ethyl phenylpropiolate; Ethyl phenylacetylenecarboxylate~Phenylpropiolic acid ethyl ester; ethyl 3-phenylprop-2-ynoate |
| MF |
C11H10O2 |
| Berat Molekul |
174.1959 |
| InChI |
InChI=1/C11H10O2/c1-2-13-11(12)9-8-10-6-4-3-5-7-10/h3-7H,2H2,1H3 |
| CAS NO |
2216-94-6 |
| EINECS |
218-703-8 |
| Struktur Molekul |
|
| Kepadatan |
1.09g/cm3 |
| Titik didih |
265°C at 760 mmHg |
| Indeks bias |
1.538 |
| Titik nyala |
124.9°C |
| Tekanan uap |
0.0094mmHg at 25°C |
| Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|