79-91-4 DL-Terebic acid
| termék neve |
DL-Terebic acid |
| Angol név |
DL-Terebic acid; Tetrahydro-2,2-dimethyl-5-oxo-3-furancarboxylic acid; Terebicacid; 2,2-dimethyl-5-oxotetrahydrofuran-3-carboxylic acid; Terebic acid; (3S)-2,2-dimethyl-5-oxotetrahydrofuran-3-carboxylate; (3R)-2,2-dimethyl-5-oxotetrahydrofuran-3-carboxylate |
| MF |
C7H9O4 |
| Molekulat?meg |
157.1445 |
| InChI |
InChI=1/C7H10O4/c1-7(2)4(6(9)10)3-5(8)11-7/h4H,3H2,1-2H3,(H,9,10)/p-1/t4-/m0/s1 |
| CAS-szám |
79-91-4 |
| EINECS |
201-233-2 |
| Molekuláris szerkezete |
|
| Olvadáspont |
175-180℃ |
| Forráspont |
347.6°C at 760 mmHg |
| Gyulladáspont |
148.6°C |
| G?znyomás |
9.29E-06mmHg at 25°C |
| Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|