6652-28-4 Benzoin isopropyl ether
| termék neve |
Benzoin isopropyl ether |
| Angol név |
Benzoin isopropyl ether; alpha-Isopropoxy-alpha-phenylacetophenone; 1,2-diphenyl-2-(propan-2-yloxy)ethanone; (2S)-1,2-diphenyl-2-(propan-2-yloxy)ethanone; (2R)-1,2-diphenyl-2-(propan-2-yloxy)ethanone; 2-hydroxy-1,2-diphenylethanone - 2-(propan-2-yloxy)propane (1:1) |
| MF |
C20H26O3 |
| Molekulat?meg |
314.4186 |
| InChI |
InChI=1/C14H12O2.C6H14O/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12;1-5(2)7-6(3)4/h1-10,13,15H;5-6H,1-4H3 |
| CAS-szám |
6652-28-4 |
| EINECS |
229-677-2 |
| Molekuláris szerkezete |
|
| Forráspont |
430.4°C at 760 mmHg |
| Gyulladáspont |
143.8°C |
| G?znyomás |
3.59E-08mmHg at 25°C |
| Biztonsági Leírás |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|