ChemNet > CAS > 2392-68-9 3-Chlorophenyl isothiocyanate
2392-68-9 3-Chlorophenyl isothiocyanate
| termék neve |
3-Chlorophenyl isothiocyanate |
| Angol név |
3-Chlorophenyl isothiocyanate; 3-Chloroisothiocyanatobenzene; 1-chloro-3-isothiocyanatobenzene |
| MF |
C7H4ClNS |
| Molekulat?meg |
169.6314 |
| InChI |
InChI=1/C7H4ClNS/c8-6-2-1-3-7(4-6)9-5-10/h1-4H |
| CAS-szám |
2392-68-9 |
| Molekuláris szerkezete |
|
| S?r?ség |
1.21g/cm3 |
| Forráspont |
249.5°C at 760 mmHg |
| T?résmutató |
1.593 |
| Gyulladáspont |
117.4°C |
| G?znyomás |
0.0361mmHg at 25°C |
| Veszély szimbólumok |
Xn:Harmful;
|
| Kockázatot kódok |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|