ChemNet > CAS > 761-02-4 triethylammonium sulphamate
761-02-4 triethylammonium sulphamate
| Ονομασ?α του προ??ντο? |
triethylammonium sulphamate |
| Αγγλικ? ?νομα |
triethylammonium sulphamate;Sulfamic acid, compd. with N,N-diethylethanamine (1:1); Sulfamic acid, compd. with triethylamine (1:1); Triethylamine sulfamate; Triethylammonium sulphamate; sulfamic acid - N,N-diethylethanamine (1:1) |
| MF |
C6H18N2O3S |
| Μοριακ? β?ρο? |
198.2837 |
| InChI |
InChI=1/C6H15N.H3NO3S/c1-4-7(5-2)6-3;1-5(2,3)4/h4-6H2,1-3H3;(H3,1,2,3,4) |
| CAS ΟΧΙ |
761-02-4 |
| EINECS |
212-087-4 |
| Μοριακ? δομ? |
|
| Σημε?ο βρασμο? |
90.5°C at 760 mmHg |
| Σημε?ο αν?φλεξη? |
152.2°C |
| Π?εση ατμ?ν |
56.1mmHg at 25°C |
|