ChemNet > CAS > 332-51-4 (4-fluorophenylthio)acetic acid
332-51-4 (4-fluorophenylthio)acetic acid
| Ονομασ?α του προ??ντο? |
(4-fluorophenylthio)acetic acid |
| Αγγλικ? ?νομα |
(4-fluorophenylthio)acetic acid; 2-[(4-Fluorophenyl)thio]acetic acid; [(4-fluorophenyl)sulfanyl]acetic acid; [(4-fluorophenyl)sulfanyl]acetate; 2-(4-Fluorophenylthio)acetic acid |
| MF |
C8H6FO2S |
| Μοριακ? β?ρο? |
185.196 |
| InChI |
InChI=1/C8H7FO2S/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5H2,(H,10,11)/p-1 |
| CAS ΟΧΙ |
332-51-4 |
| Μοριακ? δομ? |
|
| Σημε?ο τ?ξη? |
76-79℃ |
| Σημε?ο βρασμο? |
315.4°C at 760 mmHg |
| Σημε?ο αν?φλεξη? |
144.5°C |
| Π?εση ατμ?ν |
0.000185mmHg at 25°C |
| Σ?μβολα επικινδυν?τητα? |
Xi:Irritant;
|
| Κινδ?νου Κ?δικε? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφ? τη? ασφ?λεια? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|