ChemNet > CAS > 3125-73-3 3-Iodophenyl isothiocyanate
3125-73-3 3-Iodophenyl isothiocyanate
| Ονομασ?α του προ??ντο? |
3-Iodophenyl isothiocyanate |
| Αγγλικ? ?νομα |
3-Iodophenyl isothiocyanate;3-Iodophenylisothiocyanate; 1-Iodo-3-isothiocyanatobenzene; 3-IPI; Isothiocyanic acid, m-iodophenyl ester; m-Iodophenylisothiocyanate; Benzene, 1-iodo-3-isothiocyanato- |
| MF |
C7H4INS |
| Μοριακ? β?ρο? |
261.0828 |
| InChI |
InChI=1/C7H4INS/c8-6-2-1-3-7(4-6)9-5-10/h1-4H |
| CAS ΟΧΙ |
3125-73-3 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
1.76g/cm3 |
| Σημε?ο βρασμο? |
318.1°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.672 |
| Σημε?ο αν?φλεξη? |
146.2°C |
| Π?εση ατμ?ν |
0.000689mmHg at 25°C |
| Κινδ?νου Κ?δικε? |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφ? τη? ασφ?λεια? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|