2998-04-1 Diallyl adipate
| Ονομασ?α του προ??ντο? |
Diallyl adipate |
| Αγγλικ? ?νομα |
Diallyl adipate; Diallyl adipate, (Adipic acid diallyl ester); Adipic acid diallyl ester; diprop-2-en-1-yl hexanedioate |
| MF |
C12H18O4 |
| Μοριακ? β?ρο? |
226.2689 |
| InChI |
InChI=1/C12H18O4/c1-3-9-15-11(13)7-5-6-8-12(14)16-10-4-2/h3-4H,1-2,5-10H2 |
| CAS ΟΧΙ |
2998-04-1 |
| EINECS |
221-071-6 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
1.011g/cm3 |
| Σημε?ο βρασμο? |
288.4°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.454 |
| Σημε?ο αν?φλεξη? |
133.8°C |
| Π?εση ατμ?ν |
0.00234mmHg at 25°C |
| Κινδ?νου Κ?δικε? |
R21/22:Harmful in contact with skin and if swallowed.;
|
| Περιγραφ? τη? ασφ?λεια? |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|