ChemNet > CAS > 2596-47-6 4-Acetoxy-3-methoxycinnamic acid
2596-47-6 4-Acetoxy-3-methoxycinnamic acid
| Ονομασ?α του προ??ντο? |
4-Acetoxy-3-methoxycinnamic acid |
| Αγγλικ? ?νομα |
4-Acetoxy-3-methoxycinnamic acid;2-Propenoic acid, 3-(4-(acetyloxy)-3-methoxyphenyl)-; 3-Methoxy-4-acetoxycinnamic acid; AI3-23455; Acetylferulic acid; Cinnamic acid, 4-acetoxy-3-methoxy-; Cinnamic acid, 4-hydroxy-3-methoxy-, acetate; NSC 16957; 3-[4-(acetyloxy)-3-methoxyphenyl]prop-2-enoic acid; (2E)-3-[4-(acetyloxy)-3-methoxyphenyl]prop-2-enoic acid |
| MF |
C12H12O5 |
| Μοριακ? β?ρο? |
236.2207 |
| InChI |
InChI=1/C12H12O5/c1-8(13)17-10-5-3-9(4-6-12(14)15)7-11(10)16-2/h3-7H,1-2H3,(H,14,15)/b6-4+ |
| CAS ΟΧΙ |
2596-47-6 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
1.265g/cm3 |
| Σημε?ο βρασμο? |
371.9°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.575 |
| Σημε?ο αν?φλεξη? |
141.6°C |
| Π?εση ατμ?ν |
3.44E-06mmHg at 25°C |
| Κινδ?νου Κ?δικε? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφ? τη? ασφ?λεια? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|