ChemNet > CAS > 1721-26-2 ethyl 2-methylnicotinate
1721-26-2 ethyl 2-methylnicotinate
| Ονομασ?α του προ??ντο? |
ethyl 2-methylnicotinate |
| Αγγλικ? ?νομα |
ethyl 2-methylnicotinate; Ethyl 2-methylpyridine-3-carboxylate~2-Methylnicotinic acid ethyl ester; 2-Methylnicotinic acid ethyl ester; ethyl 2-methylpyridine-3-carboxylate |
| MF |
C9H11NO2 |
| Μοριακ? β?ρο? |
165.1891 |
| InChI |
InChI=1/C9H11NO2/c1-3-12-9(11)8-5-4-6-10-7(8)2/h4-6H,3H2,1-2H3 |
| CAS ΟΧΙ |
1721-26-2 |
| EINECS |
217-013-4 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
1.077g/cm3 |
| Σημε?ο βρασμο? |
234.7°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.506 |
| Σημε?ο αν?φλεξη? |
86°C |
| Π?εση ατμ?ν |
0.0521mmHg at 25°C |
| Κινδ?νου Κ?δικε? |
R36/38:Irritating to eyes and skin.;
|
| Περιγραφ? τη? ασφ?λεια? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|