853-39-4 Decafluorobenzophenone
| Nom |
Decafluorobenzophenone |
| Nom anglais |
Decafluorobenzophenone; |
| Formule moléculaire |
C13F10O |
| Poids Moléculaire |
362.12 |
| InChI |
InChI=1/C13F10O/c14-3-1(4(15)8(19)11(22)7(3)18)13(24)2-5(16)9(20)12(23)10(21)6(2)17 |
| Numéro de registre CAS |
853-39-4 |
| EINECS |
212-717-8 |
| Structure moléculaire |
|
| Point de fusion |
92-94℃ |
| Les symboles de danger |
Xi:Irritant;
|
| Codes des risques |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Description de sécurité |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|