13720-06-4 2,6-Dibromonaphthalene
| Nom |
2,6-Dibromonaphthalene |
| Nom anglais |
2,6-Dibromonaphthalene; |
| Formule moléculaire |
C10H6Br2 |
| Poids Moléculaire |
285.9626 |
| InChI |
InChI=1/C10H6Br2/c11-9-3-1-7-5-10(12)4-2-8(7)6-9/h1-6H |
| Numéro de registre CAS |
13720-06-4 |
| Structure moléculaire |
|
| Densité |
1.834g/cm3 |
| Point d'ébullition |
339.1°C at 760 mmHg |
| Indice de réfraction |
1.688 |
| Point d'éclair |
184.7°C |
| Pression de vapeur |
0.000184mmHg at 25°C |
| Description de sécurité |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|