99-71-8 4-sec-butylphenol
| product Name |
4-sec-butylphenol |
| CAS No |
99-71-8 |
| Synonyms |
p-(1-Methylpropyl)phenol; N-Hydroxyethyl Benzamide; Para-sec-butylphenol; 4-(butan-2-yl)phenol; 4-(2-Butyl)Phenol |
| Molecular Formula |
C10H14O |
| Molecular Weight |
150.2176 |
| InChI |
InChI=1/C10H14O/c1-3-8(2)9-4-6-10(11)7-5-9/h4-8,11H,3H2,1-2H3 |
| EINECS |
202-781-5 |
| Molecular Structure |
|
| Density |
0.972g/cm3 |
| Melting point |
46-59℃ |
| Boiling point |
241°C at 760 mmHg |
| Refractive index |
1.52 |
| Flash point |
107.4°C |
| Vapour Pressur |
0.0237mmHg at 25°C |
| Hazard Symbols |
C:Corrosive;
|
| Risk Codes |
R34:;
|
| Safety Description |
S26:;
S27:;
S28:;
S36/37/39:;
S45:;
|
|
Featured China Suppliers
| Telephone |
+86-432-63501905 63501910 |
| Email |
jiuxin@jiuxin.net |
| Address |
Jilin Economic Development Zone, Jilin, China |
| Contact |
Mr Li |
| Telephone |
+86-730-3289988;3087309;+86-13974042070 |
| Email |
lahlql@vip.sina.com |
| Address |
Room1006-1008, 10th floor, Building 47th, Midea Wutong Manor, No.518 Baling East Road,Yueyang City,Hunan |
| Specifications |
99% min |
| Packing |
25kg 50kg drum or bag |
| Description |
Appearance: A solid ranging from pale yellow to light beige?? Assay:99%min by HPLC?? IR Identity: conform to standard?? HNMR?? conform to standard?? carbon spectrum: conform to standard?? Water by K. F.:0.5% max or as per the customer??s request?? Loss on drying:0.5% max. or as per the customer??s request?? use: N-Hydroxyethyl Benzamide) In terms of applications, this compound is primarily used as an intermediate for synthesizing other chemicals, such as in the production processes of pharmaceuticals, pesticides, or fine chemicals. |
| Contact |
Mr. Alexander Wang |
| Telephone |
+86-22-83739603 |
| Email |
sales@yuansu-reagent.com |
| Address |
No. 268, Yuliang Street, Dagang Street, Binhai New Area, Tianjin, China |