942-92-7 Hexanophenone
| product Name |
Hexanophenone |
| CAS No |
942-92-7 |
| Synonyms |
n-Amyl phenyl ketone; Phenyl n-pentyl ketone; Amyl phenyl ketone; 1-phenylhexan-1-one |
| Molecular Formula |
C12H16O |
| Molecular Weight |
176.2548 |
| InChI |
InChI=1/C12H16O/c1-2-3-5-10-12(13)11-8-6-4-7-9-11/h4,6-9H,2-3,5,10H2,1H3 |
| EINECS |
213-394-6 |
| Molecular Structure |
|
| Density |
0.942g/cm3 |
| Melting point |
25-26℃ |
| Boiling point |
265°C at 760 mmHg |
| Refractive index |
1.498 |
| Flash point |
105.5°C |
| Vapour Pressur |
0.0094mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Telephone |
+86-515-84383198 |
| Email |
dgp@dgpharm.com |
| Address |
Binhai Coastal Industrial Park, Yancheng City, Jiangsu Province, China |
| Contact |
Chang Cheng; Yan Zhenyu |
| Telephone |
+86-25-58392388-600 |
| Email |
yanliuxin@sinohighchem.com |
| Address |
No. 51 Chongfu Road,Nanjing Chemical Industrial Park,Nanjing City 210047,China |