83-27-2 Diethyl sec-Butylmalonate
| product Name |
Diethyl sec-Butylmalonate |
| CAS No |
83-27-2 |
| Synonyms |
Butylmalonicaciddiethylester; sec-Butylmalonic acid diethyl ester; diethyl butan-2-ylpropanedioate; diethyl [(1S)-1-methylpropyl]propanedioate; diethyl [(1R)-1-methylpropyl]propanedioate |
| Molecular Formula |
C11H20O4 |
| Molecular Weight |
216.2741 |
| InChI |
InChI=1/C11H20O4/c1-5-8(4)9(10(12)14-6-2)11(13)15-7-3/h8-9H,5-7H2,1-4H3/t8-/m1/s1 |
| EINECS |
201-463-3 |
| Molecular Structure |
|
| Density |
0.992g/cm3 |
| Boiling point |
247.5°C at 760 mmHg |
| Refractive index |
1.431 |
| Flash point |
103.1°C |
| Vapour Pressur |
0.0256mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|