670-95-1 4-Phenylimidazole
| product Name |
4-Phenylimidazole |
| CAS No |
670-95-1 |
| Synonyms |
1H-imidazole, 4-phenyl-; 1H-imidazole, 5-phenyl-; 4-Phenyl-1H-imidazol; 4-phenyl-1H-imidazole; 5-Phenyl-1H-imidazole; 5-phenyl-1H-imidazole hydrochloride (1:1); 4-Phenylimi dazole |
| Molecular Formula |
C9H9ClN2 |
| Molecular Weight |
180.6342 |
| InChI |
InChI=1/C9H8N2.ClH/c1-2-4-8(5-3-1)9-6-10-7-11-9;/h1-7H,(H,10,11);1H |
| EINECS |
211-580-1 |
| Molecular Structure |
|
| Melting point |
128-131℃ |
| Boiling point |
379.8°C at 760 mmHg |
| Flash point |
213°C |
| Vapour Pressur |
1.24E-05mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Mr Huang |
| Telephone |
+86-571-86066502;18958062155 |
| Email |
sales@shuypharm.com |
| Address |
No. 590, Wenyi West Road, Hangzhou, Zhejiang, China |
| Contact |
Rice Shou |
| Telephone |
+86-571-85376473 |
| Email |
riceshou@wenleechemical.com |
| Address |
Room 202, Building 8, No. 188 North Qiutao Road, Jianggan District, Hangzhou, Zhejiang, China |