6247-28-5 Mordant Brown 6
| product Name |
Mordant Brown 6 |
| CAS No |
6247-28-5 |
| Synonyms |
4,6-Dinitro-4-methyl-2,2-azodiphenol; C.I. 11875; C.I. Mordant Brown 6; Mordant Brown 6 (C.I.); 2-[2-(3-methyl-6-oxocyclohexa-2,4-dien-1-ylidene)hydrazino]-4,6-dinitrophenolate |
| Molecular Formula |
C13H9N4O6 |
| Molecular Weight |
317.2343 |
| InChI |
InChI=1/C13H10N4O6/c1-7-2-3-12(18)9(4-7)14-15-10-5-8(16(20)21)6-11(13(10)19)17(22)23/h2-6,15,19H,1H3/p-1 |
| EINECS |
228-363-2 |
| Molecular Structure |
|
| Boiling point |
454.105°C at 760 mmHg |
| Flash point |
228.434°C |
| Vapour Pressur |
0mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|