6137-26-4 4-Dodecanone
| product Name |
4-Dodecanone |
| CAS No |
6137-26-4 |
| Synonyms |
n-Octyl n-propyl ketone; dodecan-4-one; (2E)-N-(4-bromophenyl)-3-(5-methylfuran-2-yl)prop-2-enamide |
| Molecular Formula |
C14H12BrNO2 |
| Molecular Weight |
306.1546 |
| InChI |
InChI=1/C14H12BrNO2/c1-10-2-7-13(18-10)8-9-14(17)16-12-5-3-11(15)4-6-12/h2-9H,1H3,(H,16,17)/b9-8+ |
| EINECS |
228-116-9 |
| Molecular Structure |
|
| Density |
1.481g/cm3 |
| Boiling point |
456.4°C at 760 mmHg |
| Refractive index |
1.658 |
| Flash point |
229.8°C |
| Vapour Pressur |
1.62E-08mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|