553-86-6 2-Coumaranone
| product Name |
2-Coumaranone |
| CAS No |
553-86-6;111783-83-6 |
| Synonyms |
3H-Benzofuran-2-one; 2,3-Dihydrobenzofuran-2-one; 2,3-Dihydrobenzo[b]furan-2-one; Benzofuran-2(3H)-one; 2(3H)-Benzofuranone; Benzo-furanone; 1-benzofuran-2(3H)-one; Coumarone-2(3H)-ketone; Benzofuranone |
| Molecular Formula |
C8H6O2 |
| Molecular Weight |
134.132 |
| InChI |
InChI=1/C8H6O2/c9-8-5-6-3-1-2-4-7(6)10-8/h1-4H,5H2 |
| EINECS |
209-052-0 |
| Molecular Structure |
|
| Density |
1.264g/cm3 |
| Melting point |
47-52℃ |
| Boiling point |
249°C at 760 mmHg |
| Refractive index |
1.585 |
| Flash point |
96.9°C |
| Vapour Pressur |
0.0235mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
Featured China Suppliers
| Contact |
Mr. Yan |
| Telephone |
+86-937-6982888;13306147133 |
| Email |
sales@yajiachem.cn |
| Address |
No. 9 Xingfu Road, Yumen Building Material Chemical Industrial Zone, Yumen City, Jiuquan City, Gansu Province, China |
| Contact |
Yu Jianhua |
| Telephone |
+86-518-88223188;13906148196 |
| Email |
yjh@shengfeng-chem.com |
| Address |
Weiqi Road, Jingba Road, Yanweigang, Guanyun County, Lianyungang, Jiangsu Province |
| Telephone |
+86-25-83247442/443/445/446/447 |
| Email |
sales@levachem.com |
| Address |
2112 SuNing Universal Mansion, 188 Guangzhou Road, Nanjing 210024, China |
| Contact |
Mr. Zheng |
| Telephone |
+86-592-2299609 |
| Email |
chem@chemtrade.cn |
| Address |
No. 8 Songyu Road, Xiamen, Fujian, China |
| Contact |
Mr Huang |
| Telephone |
+86-571-86066502;18958062155 |
| Email |
sales@shuypharm.com |
| Address |
No. 590, Wenyi West Road, Hangzhou, Zhejiang, China |