ChemNet > CAS > 54589-41-2 4-Benzyloxybenzophenone
54589-41-2 4-Benzyloxybenzophenone
| product Name |
4-Benzyloxybenzophenone |
| CAS No |
54589-41-2 |
| Synonyms |
[4-(benzyloxy)phenyl](phenyl)methanone |
| Molecular Formula |
C20H16O2 |
| Molecular Weight |
288.3398 |
| InChI |
InChI=1/C20H16O2/c21-20(17-9-5-2-6-10-17)18-11-13-19(14-12-18)22-15-16-7-3-1-4-8-16/h1-14H,15H2 |
| Molecular Structure |
|
| Density |
1.143g/cm3 |
| Boiling point |
451.2°C at 760 mmHg |
| Refractive index |
1.607 |
| Flash point |
199.1°C |
| Vapour Pressur |
2.48E-08mmHg at 25°C |
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|