52560-89-1 MCT
| product Name |
MCT |
| CAS No |
52560-89-1 |
| Synonyms |
2-carbamoyl-5-(2-mercapto-1,3-thiazol-4-yl)-thiophene; 5-(2-sulfanylidene-3H-1,3-thiazol-4-yl)thiophene-2-carboxamide; 5-(2-MERCAPTOTHIAZOL-4-YL)THIOPHENE-2-CARBOXAMIDE; 5-(2-Mercapto-4-thiazolyl)-2-thiophenecarboxamide; Arotinolol HCl intermediate; 5-(2-sulfanyl-1,3-thiazol-4-yl)thiophene-2-carboxamide; Arotinolol hydrochloride intermediate product; 5-(2,3-Dihydro-2-thioxo-4-thiazolyl)-2-thiophenecarboxamide |
| Molecular Formula |
C8H6N2OS3 |
| Molecular Weight |
242.341 |
| InChI |
InChI=1/C8H6N2OS3/c9-7(11)6-2-1-5(14-6)4-3-13-8(12)10-4/h1-3H,(H2,9,11)(H,10,12) |
| Molecular Structure |
|
| Density |
1.63g/cm3 |
| Boiling point |
471.1°C at 760 mmHg |
| Refractive index |
1.806 |
| Flash point |
238.7°C |
| Vapour Pressur |
4.8E-09mmHg at 25°C |
|
Featured China Suppliers
| Telephone |
86-571-82755935 |
| Email |
sales@keriopharm.com |
| Address |
502.Shangcheng Park.Xiaoshan,Hangzhou.Zhejiang.311201.Pro.China.P.R. |
| Contact |
Manager Zhang 13956978892 |
| Telephone |
+86-551-63872698,63872688 |
| Email |
info@cheerfine.com |
| Address |
West crossing of Hefei Economic Development Development Tangkou Road and Baizhang Road, Anhui, China. |