ChemNet > CAS > 492-99-9 1,2-Cyclohexanedione dioxime
492-99-9 1,2-Cyclohexanedione dioxime
| product Name |
1,2-Cyclohexanedione dioxime |
| CAS No |
492-99-9 |
| Synonyms |
Nioxime?Nioxime(rg; N-hydroxy-2-nitrosocyclohex-1-en-1-amine; (1E,2E)-N,N'-dihydroxycyclohexane-1,2-diimine; (1Z,2E)-N,N'-dihydroxycyclohexane-1,2-diimine |
| Molecular Formula |
C6H10N2O2 |
| Molecular Weight |
142.1558 |
| InChI |
InChI=1/C6H10N2O2/c9-7-5-3-1-2-4-6(5)8-10/h9-10H,1-4H2/b7-5-,8-6+ |
| EINECS |
207-769-3 |
| Molecular Structure |
|
| Density |
1.361g/cm3 |
| Melting point |
181-188℃ |
| Boiling point |
339.042°C at 760 mmHg |
| Refractive index |
1.594 |
| Flash point |
210.08°C |
| Vapour Pressur |
0mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|