462-18-0 dihexyl ketone
| product Name |
dihexyl ketone |
| CAS No |
462-18-0 |
| Synonyms |
7-Tridecanone; tridecan-7-one; hexyl ketone; di-Normal-hexyl ketone; Di-N-Hexyl Ketone; Enanthone |
| Molecular Formula |
C13H26O |
| Molecular Weight |
198.3449 |
| InChI |
InChI=1/C13H26O/c1-3-5-7-9-11-13(14)12-10-8-6-4-2/h3-12H2,1-2H3 |
| EINECS |
207-324-3 |
| Molecular Structure |
|
| Density |
0.825g/cm3 |
| Melting point |
30-32.5℃ |
| Boiling point |
260.7°C at 760 mmHg |
| Refractive index |
1.431 |
| Flash point |
79.7°C |
| Vapour Pressur |
0.0121mmHg at 25°C |
|
Featured China Suppliers
| Contact |
peter |
| Telephone |
+86-21-38681880 |
| Email |
peter.xu@synmedia-chem.com |
| Address |
2/F, Block 3, East Area of Zhangjiang High Science and |