403-90-7 3-Fluoro-DL-tyrosine
| product Name |
3-Fluoro-DL-tyrosine |
| CAS No |
403-90-7 |
| Synonyms |
H-DL-Tyr(3-F)-OH |
| Molecular Formula |
C9H10FNO3 |
| Molecular Weight |
199.179 |
| InChI |
InChI=1/C9H10FNO3/c10-6-3-5(1-2-8(6)12)4-7(11)9(13)14/h1-3,7,12H,4,11H2,(H,13,14)/t7-/m1/s1 |
| EINECS |
206-964-0 |
| Molecular Structure |
|
| Density |
1.421g/cm3 |
| Melting point |
276-280℃ |
| Boiling point |
362.4°C at 760 mmHg |
| Refractive index |
1.591 |
| Flash point |
172.9°C |
| Vapour Pressur |
6.94E-06mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|