33402-03-8 metaraminol bitartrate
| product Name |
metaraminol bitartrate |
| CAS No |
33402-03-8 |
| Synonyms |
metaraminol hydrogen (+)-tartrate; Metaraminal bitartrate
; 3-(2-amino-1-hydroxypropyl)phenol 2,3-dihydroxybutanedioate (1:1); 3-[(1R,2S)-2-amino-1-hydroxypropyl]phenol 2,3-dihydroxybutanedioate (1:1); 3-[(1R,2S)-2-amino-1-hydroxypropyl]phenol 2,3-dihydroxybutanedioate (salt); Metaraminol bitartrate |
| Molecular Formula |
C13H19NO8 |
| Molecular Weight |
317.2919 |
| InChI |
InChI=1/C9H13NO2.C4H6O6/c1-6(10)9(12)7-3-2-4-8(11)5-7;5-1(3(7)8)2(6)4(9)10/h2-6,9,11-12H,10H2,1H3;1-2,5-6H,(H,7,8)(H,9,10)/t6-,9-;/m0./s1 |
| EINECS |
251-502-3 |
| Molecular Structure |
|
| Boiling point |
357.9°C at 760 mmHg |
| Flash point |
170.3°C |
| Vapour Pressur |
9.58E-06mmHg at 25°C |
| Hazard Symbols |
T:Toxic;
|
| Risk Codes |
R23/24/25:;
|
| Safety Description |
S26:;
S28:;
S36/37/39:;
S45:;
|
|
Featured China Suppliers
| Telephone |
0086-519-83138042;83137042;83137041;0086-519-83139028(english);83131668(english) |
| Email |
info@sunlightchem.com |
| Address |
JiuliStreet, Benniu Town Changzhou, Jiangsu Province, China. |
| Contact |
Li Chun |
| Telephone |
+86-519-82891186;82618618;82618688 |
| Email |
henrylee215@gmail.com |
| Address |
3 # Houyang chemical zone,Gold town,Jintan,Jiangsu,China |
| Telephone |
86-576-85689892 |
| Email |
sales@wonderfult.com |
| Address |
Economy development area Yongquan, Linhai City, Zhejiang P.R. of China |
| Contact |
Mr. Wei Fei ( Managing Director) Mrs. Lanny Cao ( Director) |
| Telephone |
+86-571-85232125;85232161;85134551 |
| Email |
info@afinechem.com;sales@afinechem.com |
| Address |
7-601 ,Xigang Xinjie, Xihu Industrial Park, Sandun Town,Hangzhou 310030, China |
| Contact |
Miss. Sucy |
| Telephone |
+86 755 27800161 |
| Email |
sales@todabio.com |
| Address |
5th Floor, Building 8, Changyuan New Material Port, No. 2, Gaoxin Zhongyi, Science and Technology Park, Nanshan District, Shenzhen |