ChemNet > CAS > 31680-07-6 Methylnitrobenzaldehyde
31680-07-6 Methylnitrobenzaldehyde
| product Name |
Methylnitrobenzaldehyde |
| CAS No |
31680-07-6 |
| Synonyms |
4-Methyl-3-nitrobenzaldehyde; Benzaldehyde, 4-methyl-3-nitro-; WLN IS WNR B1 EVH [WLN] |
| Molecular Formula |
C8H7NO3 |
| Molecular Weight |
165.1461 |
| InChI |
InChI=1/C8H7NO3/c1-6-2-3-7(5-10)4-8(6)9(11)12/h2-5H,1H3 |
| EINECS |
250-760-4 |
| Molecular Structure |
|
| Density |
1.278g/cm3 |
| Melting point |
43-54℃ |
| Boiling point |
276.3°C at 760 mmHg |
| Refractive index |
1.602 |
| Flash point |
130.1°C |
| Vapour Pressur |
0.00485mmHg at 25°C |
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|