29114-66-7 p-Fluorovalerophenone
| product Name |
p-Fluorovalerophenone |
| CAS No |
29114-66-7 |
| Synonyms |
4-Fluorovalerophenone; n-Butyl 4-fluorophenyl ketone; 1-(4-fluorophenyl)pentan-1-one; 4'-FLUOROVALEROPHENONE |
| Molecular Formula |
C11H13FO |
| Molecular Weight |
180.2187 |
| InChI |
InChI=1/C11H13FO/c1-2-3-4-11(13)9-5-7-10(12)8-6-9/h5-8H,2-4H2,1H3 |
| EINECS |
211-907-8 |
| Molecular Structure |
|
| Density |
1.031g/cm3 |
| Melting point |
23-25℃ |
| Boiling point |
253.1°C at 760 mmHg |
| Refractive index |
1.486 |
| Flash point |
100.2°C |
| Vapour Pressur |
0.0186mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|