2873-74-7 Glutaryl dichloride
| product Name |
Glutaryl dichloride |
| CAS No |
2873-74-7 |
| Synonyms |
Glutaryl chloride; Pentanedioyl dichloride~1,3-Propanedicarbonyl chloride; pentanedioyl dichloride |
| Molecular Formula |
C5H6Cl2O2 |
| Molecular Weight |
169.0059 |
| InChI |
InChI=1/C5H6Cl2O2/c6-4(8)2-1-3-5(7)9/h1-3H2 |
| EINECS |
220-711-1 |
| Molecular Structure |
|
| Density |
1.319g/cm3 |
| Boiling point |
217.8°C at 760 mmHg |
| Refractive index |
1.458 |
| Flash point |
106.7°C |
| Vapour Pressur |
0.13mmHg at 25°C |
| Hazard Symbols |
C:Corrosive;
|
| Risk Codes |
R22:Harmful if swallowed.;
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Jason Jing |
| Telephone |
+86-571-85586718 |
| Email |
sales@capot.com |
| Address |
Wanlun Sci Park,No.88 Jiangling RD,Hangzhou, Zhejiang, China, 310051 |