ChemNet > CAS > 2700-22-3 Benzylidenemalononitrile
2700-22-3 Benzylidenemalononitrile
| product Name |
Benzylidenemalononitrile |
| CAS No |
2700-22-3 |
| Synonyms |
beta,beta-styrenedicarbonitrile; Benzalmalononitrile; 2-benzylidenemalononitrile; benzylidenepropanedinitrile |
| Molecular Formula |
C10H6N2 |
| Molecular Weight |
154.168 |
| InChI |
InChI=1/C10H6N2/c11-7-10(8-12)6-9-4-2-1-3-5-9/h1-6H |
| EINECS |
220-283-6 |
| Molecular Structure |
|
| Density |
1.154g/cm3 |
| Melting point |
82-86℃ |
| Boiling point |
294.8°C at 760 mmHg |
| Refractive index |
1.612 |
| Flash point |
138°C |
| Vapour Pressur |
0.00159mmHg at 25°C |
| Hazard Symbols |
T:Toxic;
|
| Risk Codes |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Telephone |
+86-21-61066956/57/58??61043548 |
| Email |
sales@domen.com.cn |
| Address |
Rm1907, Bldg A, No.1088 Xinjinqiao Rd, Pudong, Shanghai, China |