2444-68-0 9-Vinylanthracene
| product Name |
9-Vinylanthracene |
| CAS No |
2444-68-0 |
| Synonyms |
9-Ethenylanthracen; Anthracene, 9-ethenyl- (9CI); 9-ethenylanthracene |
| Molecular Formula |
C16H12 |
| Molecular Weight |
204.2665 |
| InChI |
InChI=1/C16H12/c1-2-14-15-9-5-3-7-12(15)11-13-8-4-6-10-16(13)14/h2-11H,1H2 |
| EINECS |
219-486-2 |
| Molecular Structure |
|
| Density |
1.112g/cm3 |
| Melting point |
64-66℃ |
| Boiling point |
377°C at 760 mmHg |
| Refractive index |
1.724 |
| Flash point |
172.4°C |
| Vapour Pressur |
1.51E-05mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|