243-17-4 2,3-Benzofluorene
| product Name |
2,3-Benzofluorene |
| CAS No |
243-17-4 |
| Synonyms |
11H-Benzo[b]fluorene; benzo(b)fluorene |
| Molecular Formula |
C17H12 |
| Molecular Weight |
216.2772 |
| InChI |
InChI=1/C17H12/c1-2-6-13-11-17-15(9-12(13)5-1)10-14-7-3-4-8-16(14)17/h1-9,11H,10H2 |
| EINECS |
205-952-2 |
| Molecular Structure |
|
| Density |
1.185g/cm3 |
| Melting point |
206-214℃ |
| Boiling point |
398.3°C at 760 mmHg |
| Refractive index |
1.714 |
| Flash point |
185.4°C |
| Vapour Pressur |
3.43E-06mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|