2216-94-6 Ethyl phenylpropiolate
| product Name |
Ethyl phenylpropiolate |
| CAS No |
2216-94-6 |
| Synonyms |
Ethyl phenylacetylenecarboxylate~Phenylpropiolic acid ethyl ester; ethyl 3-phenylprop-2-ynoate |
| Molecular Formula |
C11H10O2 |
| Molecular Weight |
174.1959 |
| InChI |
InChI=1/C11H10O2/c1-2-13-11(12)9-8-10-6-4-3-5-7-10/h3-7H,2H2,1H3 |
| EINECS |
218-703-8 |
| Molecular Structure |
|
| Density |
1.09g/cm3 |
| Boiling point |
265°C at 760 mmHg |
| Refractive index |
1.538 |
| Flash point |
124.9°C |
| Vapour Pressur |
0.0094mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|