2049-73-2 1,3-Diethoxybenzene
| product Name |
1,3-Diethoxybenzene |
| CAS No |
2049-73-2 |
| Synonyms |
1,3-Diethoxybenzene, (Resorcinol diethyl ether); Resorsinol diethyl ether; Resorcinol diethyl ether |
| Molecular Formula |
C10H14O2 |
| Molecular Weight |
166.217 |
| InChI |
InChI=1/C10H14O2/c1-3-11-9-6-5-7-10(8-9)12-4-2/h5-8H,3-4H2,1-2H3 |
| EINECS |
218-071-3 |
| Molecular Structure |
|
| Density |
0.975g/cm3 |
| Melting point |
10-236℃ |
| Boiling point |
238.5°C at 760 mmHg |
| Refractive index |
1.485 |
| Flash point |
87.1°C |
| Vapour Pressur |
0.0651mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Manager Liu |
| Email |
yf79009@163.com |
| Address |
East Zone, Huazhong Shimao Wanhuo City, Longhu Town, Xinzheng City, Zhengzhou City, Henan Province, China |