2049-73-2 1,3-Diethoxybenzene
| Produkt-Name |
1,3-Diethoxybenzene |
| Englischer Name |
1,3-Diethoxybenzene; 1,3-Diethoxybenzene, (Resorcinol diethyl ether); Resorsinol diethyl ether; Resorcinol diethyl ether |
| Molekulare Formel |
C10H14O2 |
| Molecular Weight |
166.217 |
| InChI |
InChI=1/C10H14O2/c1-3-11-9-6-5-7-10(8-9)12-4-2/h5-8H,3-4H2,1-2H3 |
| CAS Registry Number |
2049-73-2 |
| EINECS |
218-071-3 |
| Molecular Structure |
|
| Dichte |
0.975g/cm3 |
| Schmelzpunkt |
10-236℃ |
| Siedepunkt |
238.5°C at 760 mmHg |
| Brechungsindex |
1.485 |
| Flammpunkt |
87.1°C |
| Dampfdruck |
0.0651mmHg at 25°C |
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|