ChemNet > CAS > 18962-05-5 4-Isopropoxybenzaldehyde
18962-05-5 4-Isopropoxybenzaldehyde
| product Name |
4-Isopropoxybenzaldehyde |
| CAS No |
18962-05-5 |
| Synonyms |
4-(propan-2-yloxy)benzaldehyde |
| Molecular Formula |
C10H12O2 |
| Molecular Weight |
164.2011 |
| InChI |
InChI=1/C10H12O2/c1-8(2)12-10-5-3-9(7-11)4-6-10/h3-8H,1-2H3 |
| Molecular Structure |
|
| Density |
1.036g/cm3 |
| Boiling point |
264.2°C at 760 mmHg |
| Refractive index |
1.529 |
| Flash point |
112.9°C |
| Vapour Pressur |
0.00982mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|