ChemNet > CAS > 1877-71-0 Methyl hydrogen isophthalate
1877-71-0 Methyl hydrogen isophthalate
| product Name |
Methyl hydrogen isophthalate |
| CAS No |
1877-71-0 |
| Synonyms |
Monomethyl isophthalate; Isophthalic acid monomethyl ester; Benzene-1,3-dicarboxylic acid monomethyl ester; 3-(methoxycarbonyl)benzoic acid; Mono-methyl isophthalate; Isophthalic acid methyl ester |
| Molecular Formula |
C9H8O4 |
| Molecular Weight |
180.1574 |
| InChI |
InChI=1/C9H8O4/c1-13-9(12)7-4-2-3-6(5-7)8(10)11/h2-5H,1H3,(H,10,11) |
| Molecular Structure |
|
| Density |
1.288g/cm3 |
| Melting point |
194-196℃ |
| Boiling point |
339.3°C at 760 mmHg |
| Refractive index |
1.556 |
| Flash point |
139.6°C |
| Vapour Pressur |
3.6E-05mmHg at 25°C |
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
Featured China Suppliers
| Contact |
Mr Chen Wei-dong |
| Telephone |
+86-21-64251386 |
| Email |
wdchen@shwychem.com |
| Address |
HQ in Shanghai: 4st Floor S&T Industry Building, 130 Meilong Road, Shanghai200237,China |