1820-81-1 5-Chlorouracil
| product Name |
5-Chlorouracil |
| CAS No |
1820-81-1 |
| Synonyms |
2,4(1H,3H)-Pyrimidinedione, 5-chloro-; AI3-26560; NSC 28172; Uracil, 5-chloro-; Uracil, 5-chloro- (VAN); 5-chloropyrimidine-2,4(1H,3H)-dione |
| Molecular Formula |
C4H3ClN2O2 |
| Molecular Weight |
146.5318 |
| InChI |
InChI=1/C4H3ClN2O2/c5-2-1-6-4(9)7-3(2)8/h1H,(H2,6,7,8,9) |
| EINECS |
217-339-7 |
| Molecular Structure |
|
| Density |
1.61g/cm3 |
| Melting point |
>300℃ |
| Boiling point |
413.6°C at 760 mmHg |
| Refractive index |
1.587 |
| Flash point |
203.9°C |
| Vapour Pressur |
1.98E-07mmHg at 25°C |
| Safety Description |
S22:;
S24/25:;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Mr.Chen |
| Telephone |
+86-571-87040515 |
| Email |
chenhk@hzph.com |
| Address |
QinglianBldg.No,139QingchunRd,HangzhouCity,Zhejiang,China |
| Contact |
Zhang Zhaolin |
| Telephone |
86 21 6840 6146/6147/6148 |
| Email |
sales@megchem.cn |
| Address |
Room 19E No.58 Xiangcheng Road,Pudong,Shanghai 200122,China |
| Packing |
25kg/barrel |
| Description |
1. Name: Cytosine. 2. CAS NO.: 71-30-7. 3. Assay: 99.0% min. 4. High quality and favorable price. 5. Professional supplier. |
| Contact |
ivy shao |
| Telephone |
86-373-2513 858 |
| Email |
sales@tianfengchem.com;swz@tianfengchem.com |
| Address |
East of Huanyu Avenue, Xinxiang, Henan, China |
| Telephone |
+86-21-55228382 55228380 |
| Email |
info@youshenghg.com |
| Address |
Room 906,Xieyou Tower,NO.21,#118 Zhengtong Road,Shanghai China |
| Contact |
Mr.Chen |
| Telephone |
+86-571-85095566;18969113688 |
| Email |
sales@nwchemical.com |
| Address |
Room 803, Qinglian Bldg, No 139 Qingchun Road, Hangzhou, Zhejiang China |