ChemNet > CAS > 17422-74-1 Chromone-3-carboxaldehyde
17422-74-1 Chromone-3-carboxaldehyde
| product Name |
Chromone-3-carboxaldehyde |
| CAS No |
17422-74-1 |
| Synonyms |
3-Formylchromone; 4-oxo-4H-chromene-3-carbaldehyde |
| Molecular Formula |
C10H6O3 |
| Molecular Weight |
174.1528 |
| InChI |
InChI=1/C10H6O3/c11-5-7-6-13-9-4-2-1-3-8(9)10(7)12/h1-6H |
| EINECS |
241-451-5 |
| Molecular Structure |
|
| Density |
1.431g/cm3 |
| Melting point |
151-152℃ |
| Boiling point |
303.1°C at 760 mmHg |
| Refractive index |
1.687 |
| Flash point |
134.7°C |
| Vapour Pressur |
0.000951mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Mr. Wei |
| Telephone |
+86-573-82813637;82813639 |
| Email |
sales@jlightchem.com |
| Address |
Dongtang slip, Jiaxing Industrial Park, Daqiao Town, Jiaxing, Zhejiang, China. |