1701-69-5 4-Propionylpyridine
| product Name |
4-Propionylpyridine |
| CAS No |
1701-69-5 |
| Synonyms |
Ethyl 4-pyridyl ketone; 1-(4-Pyridyl)-1-propanone; 1-(pyridin-4-yl)propan-1-one |
| Molecular Formula |
C8H9NO |
| Molecular Weight |
135.1632 |
| InChI |
InChI=1/C8H9NO/c1-2-8(10)7-3-5-9-6-4-7/h3-6H,2H2,1H3 |
| Molecular Structure |
|
| Density |
1.034g/cm3 |
| Boiling point |
229.7°C at 760 mmHg |
| Refractive index |
1.508 |
| Flash point |
98.2°C |
| Vapour Pressur |
0.0684mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|